Salicylsalicylic acid
Salicylsalicylic acid is a nonsteroidal oral anti-inflammatory agent. Relative to other NSAIDs, it has a weak inhibitory effect on the cyclooxygenase enzyme and decreases the production of several pro inflammatory chemical signals such as interleukin-6, TNF-alpha, and C-reactive protein.
| Supplier | BOC Sciences |
|---|---|
| Product # | 552-94-3 |
| Pricing | Inquire |
| Cas | 552-94-3 |
| Molecular Weight | 258.23 |
| Molecular Formula | C14H10O5 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)OC2=CC=CC=C2C(=O)O)O |