Methyl 2,3,4-tri-O-benzyl-6-O-trityl-a-D-galactopyranoside
Methyl 2,3,4-tri-O-benzyl-6-O-trityl-α-D-galactopyranoside, a paramount substance in the realm of biomedicine, stands as a crucial conduit in the amalgamation of diverse therapeutic agents for the amelioration of malignant neoplasms, glycemic irregularities, and neurological infirmities. Manifesting its indispensability, this product significantly propels the horizons of inquiry and advancements in pharmaceutical realms, efficaciously fostering the genesis of formidable curatives to combat afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2595-06-4 |
| Pricing | Inquire |
| Cas | 2595-06-4 |
| Molecular Weight | 706.89 |
| Molecular Formula | C47H46O6 |
| Canonical SMILES | COC1C(C(C(C(O1)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6)OCC7=CC=CC=C7 |