5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate
5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate: This product is a natural compound used for studying cardiovascular diseases. It acts as an inhibitor targeting specific enzymes involved in the progression of these diseases. Its precise mechanism of action aids in reducing inflammation and enhancing cardiac functionality.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5327 |
| Pricing | Inquire |
| Cas | 1269839-24-8 |
| Molecular Weight | 358.428 |
| Molecular Formula | C21H26O5 |
| Canonical SMILES | CC(=O)OC(CCC1=CC=C(C=C1)O)CC(CCC2=CC=C(C=C2)O)O |