ELENAIC ACID
ELENAIC ACID is a potential treatment for cancer due to its apoptotic and anti-proliferative effects on cancer cells. It has shown promise in inhibiting tumor growth and inducing cell death in various cancer types.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34422-12-3 |
| Pricing | Inquire |
| Cas | 34422-12-3 |
| Molecular Weight | 242.23 |
| Molecular Formula | C11H14O6 |
| Canonical SMILES | CC1C(C(C(=CO1)C(=O)OC)CC(=O)O)C=O |