2'-O-ribosylguanosine (phosphate)
2'-O-ribosylguanosine (phosphate), a pivotal biomolecule extensively utilized in the biomedical sector, serves as a fundamental constituent for the synthesis of RNA and DNA. Its inclusion of a phosphate group confers upon it a profound involvement in energy transfer and signal transduction mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 131293-20-4 |
| Pricing | Inquire |
| Cas | 131293-20-4 |
| Molecular Weight | 495.34 |
| Molecular Formula | C15H22N5O12P |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)OC4C(C(C(O4)COP(=O)(O)O)O)O)N=C(NC2=O)N |