trans-Ferulic acid
Trans-ferulic (FA) acid is a natural phenylpropanoid found in herbs of Euphorbia hylonoma, it exhibits antioxidant effects in vitro. Trans-ferulic has inhibitory effect on proliferation and migration of human lung cancer cells accompanied with increased endogenous reactive oxygen species and β-catenin instability.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5440 |
| Pricing | Inquire |
| Cas | 537-98-4 |
| Molecular Weight | 194.18 |
| Molecular Formula | C10H10O4 |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)O)O |