Y-29794
Y-29794, a novel orally non-peptide PPCE inhibitor, has shown to be able to prevent amyloid-like deposition in senescence-accelerated mice. Y-29794 exhibited potent inhibitory activity with an IC50 = 3.0 nM for both brain crude extract and partially purified enzyme fraction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129184-48-1 |
| Pricing | Inquire |
| Cas | 129184-48-1 |
| Molecular Weight | 418.66 |
| Molecular Formula | C23H34N2OS2 |
| Canonical SMILES | CC(C)C1=NC(=C(C=C1)C(=O)C2=CC=CS2)SCCCCCCCCN(C)C.C(=O)(C(=O)O)O |