Benzyl9H-carbazole-9-carbodithioate
Benzyl9H-carbazole-9-carbodithioate exerts its therapeutic potential by virtuously inhibiting key enzymes aptly implicated in the relentless advancement of certain malignant neoplasms. Remarkably, Benzyl9H-carbazole-9-carbodithioate unveils an extraordinary amalgamation of potent anti-inflammatory and antioxidative attributes, thus remaining an invaluable constituent in the realm of meticulous pharmaceutical advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 137780-73-5 |
| Pricing | Inquire |
| Cas | 137780-73-5 |
| Molecular Weight | 333.4698 |
| Molecular Formula | C20H15NS2 |
| Canonical SMILES | C1=CC=C(C=C1)CSC(=S)N2C3=CC=CC=C3C4=CC=CC=C42 |