4-Biphenylboronic acid
4-Biphenylboronic acid is a highly versatile compound that holds immense significance within the biomedical sector as a pivotal pharmaceutical intermediate. Its indispensability lies in aiding the synthesis of an array of drugs intended to combat an extensive range of ailments, including cancer, diabetes, and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5122-94-1 |
| Pricing | Inquire |
| Cas | 5122-94-1 |
| Molecular Weight | 198.03 |
| Molecular Formula | C12H11O2B |
| Canonical SMILES | B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |