5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID
5-CHLORO-2-ISOPROPOXYPHENYLBORONIC ACID is a pivotal compound in the field of biomedicine. Functioning as a pivotal stepping stone in the intricate synthesis of pharmaceutical agents targeting afflictions like cancer, diabetes, and cardiovascular disorders, this compound's allure lies in its idiosyncratic attributes. Exerting a momentous influence on the advancement of pioneering therapies and the enhancement of patient well-being, it emerges as an indispensable catalyst in propelling the frontiers of biomedical exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352534-87-3 |
| Pricing | Inquire |
| Cas | 352534-87-3 |
| Molecular Weight | 214.45 |
| Molecular Formula | C9H12BClO3 |
| Canonical SMILES | B(C1=C(C=CC(=C1)Cl)OC(C)C)(O)O |