5'-O-(4,4'-Dimethoxytrityl)-N4-benzoyl-5-methyl-2'-deoxycytidine
5'-O-(4,4'-Dimethoxytrityl)-N4-benzoyl-5-methyl-2'-deoxycytidine, a remarkable compound within the biomedical industry, presents itself as an efficacious antiviral agent. Its prowess lies in the selective eradication of herpes and hepatitis infections. By impeding viral replication and enhancing the immune response, it holds promise as a remedy for diverse viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 104579-03-5 |
| Pricing | Inquire |
| Cas | 104579-03-5 |
| Molecular Weight | 647.72 |
| Molecular Formula | C38H37N3O7 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |