Sanglifehrin B
It is a cyclophilin combination produced by the strain of Streptomyces sp. A92-308110. The affinity of Sanglifehrin B to Cyclophilin is 10-20 times stronger than Cyclosporin A. The immunosuppressive effect of Sanglifehrin is lower than Cyclosporin A by mixed lymphocyte reaction assay.
Supplier | BOC Sciences |
---|---|
Product # | BBF-02864 |
Pricing | Inquire |
Molecular Weight | 1072.37 |
Molecular Formula | C60H89N5O12 |
Canonical SMILES | CCC1CC(C2(C(=CC(C(O2)CC(C(C)CCC=CC=C(C)C3CC=CC=CC(C(C(C(C(=O)NC(C(=O)NC(C(=O)N4CCCC(N4)C(=O)O3)CC5=CC(=CC=C5)O)C(C)C)CCC(=O)C)O)C)O)O)C)C)NC1=O)C |