Clobetasol Propionate EP Impurity G
An impurity of Clobetasol propionate. Clobetasol propionate is a corticosteroid of the glucocorticoid class used to treat various skin disorders including eczema and psoriasis. It is also highly effective for contact dermatitis caused by exposure to poison ivy/oak.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1726-064125 |
| Pricing | Inquire |
| Cas | 25122-41-2 |
| Molecular Weight | 410.92 |
| Molecular Formula | C22H28ClFO4 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CCl)O)C)O)F)C |