Taiwanhomoflavone B
Taiwanhomoflavone B is a natural compound isolated from the barks of Cephalotaxus fortunei. Taiwanhomoflavone B is cytotoxic with ED(50) values of 3.8 and 3.5 microg/ml, against KB oral epidermoid carcinoma and Hepa-3B hepatoma cells, respectively.
Supplier | BOC Sciences |
---|---|
Product # | 509077-91-2 |
Pricing | Inquire |
Cas | 509077-91-2 |
Molecular Weight | 568.53 |
Molecular Formula | C32H24O10 |
Canonical SMILES | CC1=C(C=C2C(=C1O)C(=O)CC(O2)C3=CC=C(C=C3)OC4=C(C=C5C(=C4O)C(=O)C=C(O5)C6=CC=C(C=C6)O)OC)O |