Clopidogrel-MP Endo Derivative-[13C,d3]
Clopidogrel-MP Endo Derivative-[13C,d3], is the labelled analogue of Clopidogrel-MP Endo Derivative, which is a Clopidogrel derivative. Clopidogrel is an antiplatelet medication used to reduce the risk of heart disease and stroke in those at high risk.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002319 |
| Pricing | Inquire |
| Cas | 1346597-76-9 |
| Molecular Weight | 508.01 |
| Molecular Formula | C24[13C]H23D3ClNO6S |
| Canonical SMILES | COC1=CC=CC(=C1)C(=O)CSC2=C(CN(CC2)C(C3=CC=CC=C3Cl)C(=O)OC)CC(=O)O |