3',5'-Bis-O-(t-butyldimethylsilyl)thymidine
3',5'-Bis-O-(t-butyldimethylsilyl)thymidine is a crucial compound in compound used as a precursor for synthesizing modified DNA for research purposes. It's utilized in the development of nucleoside analogs and nucleotide derivatives, aiding in the investigation of DNA functions and various diseases, including cancer, viral infections, and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40733-26-4 |
| Pricing | Inquire |
| Cas | 40733-26-4 |
| Molecular Weight | 470.75 |
| Molecular Formula | C22H42N2O5Si2 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |