3-(3'-Chlorosulfonyl-4-chlorophenyl)-3-chlorophthalide
3-(3'-Chlorosulfonyl-4-chlorophenyl)-3-chlorophthalide is a highly potent and multifaceted compound, emerging as an indispensable aid in targeting and studying specific malignancies and inflammatory ailments. Characterized by its robust anti-inflammatory and antitumor properties, this novel compound assumes a pivotal role as a crucial intermediary in the orchestration of pharmaceutical synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68592-11-0 |
| Pricing | Inquire |
| Cas | 68592-11-0 |
| Molecular Weight | 377.63 |
| Molecular Formula | C14H7Cl3O4S |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC(=C(C=C3)Cl)S(=O)(=O)Cl)Cl |