1,2,3,6-Tetra-O-benzyl-b-D-glucopyranoside
1,2,3,6-Tetra-O-benzyl-b-D-glucopyranoside, a crucial compound extensively employed in the biomedicine sector, demonstrates immense potential in drug development for diverse ailments. Acting as a vital precursor for glycoside-based molecule synthesis, this compound showcases distinctive attributes that render it indispensable in advancing innovative therapeutic agents and facilitating glycosylation investigations. It finds applications in an expansive spectrum of drug discovery endeavors, encompassing cancer, inflammation, and metabolic disorder treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67831-42-9 |
| Pricing | Inquire |
| Cas | 67831-42-9 |
| Molecular Weight | 540.65 |
| Molecular Formula | C34H36O6 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)O |