Clopidogrel-[d3] Hydrogen Sulfate
Clopidogrel-[d3] Hydrogen Sulfate, is the labelled analogue of Clopidogrel. Clopidogrel is an antiplatelet medication used to reduce the risk of heart disease and stroke in those at high risk.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002317 |
| Pricing | Inquire |
| Cas | 1217643-68-9 |
| Molecular Weight | 422.9 |
| Molecular Formula | C16H15D3ClNO6S2 |
| Canonical SMILES | COC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |