4-[2'-(7''-Deazaguanine)ethyl]benzoic acid N-hydroxysuccinimide ester
4-[2'-(7''-Deazaguanine)ethyl]benzoic acid N-hydroxysuccinimide ester is an intermediate of Pemetrexed, which is used as a single agent or in combination with other chemotherapeutic agents for the treatment of several types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 204257-65-8 |
| Pricing | Inquire |
| Cas | 204257-65-8 |
| Molecular Weight | 395.38 |
| Molecular Formula | C19H17N5O5 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)CCC3=CNC4=C3C(=O)NC(=N4)N |