Secorapamycin B
Secorapamycin B is an impurity of Rapamycin. Rapamycin is a macrolide compound. It inhibits activation of T cells and B cells by reducing the production of interleukin-2. Rapamycin can be used to coat coronary stents and prevent organ transplant rejection.
| Supplier | BOC Sciences |
|---|---|
| Product # | 185107-79-3 |
| Pricing | Inquire |
| Cas | 185107-79-3 |
| Molecular Weight | 932.19 |
| Molecular Formula | C51H81NO14 |
| Canonical SMILES | CC1CCC(OC1(C(=O)C(=O)N2CCCCC2C(=O)O)O)CC(C(=CC=CC=CC(C)CC(C)C(=O)C(C(C(=CC(C)C(=O)CC(C(C)CC3CCC(C(C3)OC)O)O)C)O)OC)C)OC |