Forsythoside B
Forsythoside B exerted potent neuroprotective effects with a favorable therapeutic time-window, reduce of cerebral ischemia and reperfusion injury degree, attenuating blood-brain barrier (BBB) breakdown, and its protective effects may be due to inhibition of inflammatory response.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5267 |
| Pricing | Inquire |
| Cas | 81525-13-5 |
| Molecular Weight | 756.7 |
| Molecular Formula | C34H44O19 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)COC4C(C(CO4)(CO)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O |