Beclomethasone Dipropionate Impurity B
Beclomethasone Dipropionate Impurity B is an impurity of beclomethasone dipropionate which known for its role as a glucocorticoid receptor agonist and extensively employed for treating respiratory conditions including asthma and allergies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5534-08-7 |
| Pricing | Inquire |
| Cas | 5534-08-7 |
| Molecular Weight | 507.03 |
| Molecular Formula | C27H35ClO7 |
| Canonical SMILES | CCC(=O)OC1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)Cl)O)C)C)C(=O)COC(=O)C |