3-METHACRYLOXYPROPYLDIMETHYLETHOXYSILANE
3-METHACRYLOXYPROPYLDIMETHYLETHOXYSILANE, a crucial coupling agent in the biomedical industry, exerts its prowess by ameliorating the adhesion amidst organic and inorganic materials. With its innate reactivity, this compound assumes a pivotal role in the surface modification, coating, and functionalization of various biomaterials.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13731-98-1 |
| Pricing | Inquire |
| Cas | 13731-98-1 |
| Molecular Weight | 230.38 |
| Molecular Formula | C11H22O3Si |
| Canonical SMILES | CCO[Si](C)(C)CCCOC(=O)C(=C)C |