trans-1-Hexen-1-ylboronic acid pinacol ester, 97%
Trans-1-Hexen-1-ylboronic acid pinacol ester, 97% is an indispensable compound in the realm of biomedicine and finds its applicability as a prized reagent for the synthesis of diverse pharmaceutical compounds and bioactive molecules. Its unparalleled purity and unwavering stability render it an optimal candidate for advancing drug development, with a particular focus on combatting specific afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126688-97-9 |
| Pricing | Inquire |
| Cas | 126688-97-9 |
| Molecular Weight | 210.12 |
| Molecular Formula | C12H23BO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C=CCCCC |