β-NF-JQ1
β-NF-JQ1 is a PROTAC that recruits Aryl Hydrocarbon Receptor E3 ligase to target proteins. It uses β-NF as an AhR ligand to act directly on bromodomain-containing (BRD) proteins, induces the interaction between AhR and BRD proteins and exhibits effective anticancer activity related to protein knockdown activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2380000-55-3 |
| Pricing | Inquire |
| Cas | 2380000-55-3 |
| Molecular Weight | 816.36 |
| Molecular Formula | C45H42ClN5O6S |
| Canonical SMILES | O=C1C=C(OC=2C=CC=3C=CC=CC3C12)C=4C=CC(=CC4)COCCOCCOCCNC(=O)CC5N=C(C=6C=CC(Cl)=CC6)C7=C(SC(=C7C)C)N8C(=NN=C85)C |