2-Hydroxy-5-methanesulfonamidobenzoic Acid
4-Ethylbenzyl Chloride (CAS# 1467-05-6) can be used for oxidative degeneration of fragrant aldehydes in antiperspirant matrix leading to autoxidation and chlorinated products. It can also be used for extreme pressure additives toward lubricating oils and hydraulic fluids.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060944 |
| Pricing | Inquire |
| Cas | 926243-08-5 |
| Molecular Weight | 231.22 |
| Molecular Formula | C9H11Cl |
| Canonical SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)O)C(=O)O |