Clofentezine Metabolite 1
Clofentezine Metabolite 1 is a metabolite of Clofentezine, used for studying the pervasive spider mite infestations. A potent active ingredient pervading diverse agricultural pesticides, this metabolite exudes unparalleled prowess in decimating spider mite populations, heralding a new era of efficacious pest control.
| Supplier | BOC Sciences |
|---|---|
| Product # | 107595-49-3 |
| Pricing | Inquire |
| Cas | 107595-49-3 |
| Molecular Weight | 319.15 |
| Molecular Formula | C14H8Cl2N4O |
| Canonical SMILES | C1=CC=C(C(=C1)C2=NN=C(N=N2)C3=C(C(=CC=C3)O)Cl)Cl |