Boc-His(Trt)-Aib-OH
Boc-His(Trt)-Aib-OH, a highly specialized peptide synthesis reagent employed within the biomedical industry, presents a powerful capability for the creation of peptide sequences inclusive of unconventional amino acids. Its steadfast utilization helps to promote the generation of distinct and optimal peptide architectures, critical for the progression of targeted drug development, including the likes of Alzheimer's disease, cancer and many other diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-000828 |
| Pricing | Inquire |
| Cas | 2061897-68-3 |
| Molecular Weight | 582.7 |
| Molecular Formula | C34H38N4O5 |
| Canonical SMILES | CC(C)(C)OC(=O)NC(CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)NC(C)(C)C(=O)O |