9,9-Bis(4-amino-3-methylphenyl)fluorene
9,9-Bis(4-amino-3-methylphenyl)fluorene is a paramount compound widely utilized in the biomedical realm due to its invaluable chemical attributes. It proves integral to the advancement of groundbreaking pharmaceuticals aimed at alleviating diverse maladies. Manifesting its indispensable role within the realm of drug discovery and formulation, this product effectively enhances the potency and therapeutic prospects of medicinal interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2802 |
| Pricing | Inquire |
| Cas | 107934-60-1 |
| Molecular Weight | 376.49 |
| Molecular Formula | C27H24N2 |
| Canonical SMILES | CC1=C(C=CC(=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC(=C(C=C5)N)C)N |