2'-Deoxy-5'-O-DMT-5-iodouridine 3'-CE phosphoramidite
2'-Deoxy-5'-O-DMT-5-iodouridine 3'-CE phosphoramidite is a crucial component in the biomedicine industry. It is employed for the synthesis of modified oligonucleotides with potent therapeutic potential. By incorporating this phosphoramidite, the resulting oligonucleotides display enhanced drug efficacy against specific diseases, such as cancer, viral infections, or genetic disorders. This product serves as a valuable tool for researchers and pharmaceutical companies striving to develop innovative nucleotide-based therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 178925-48-9 |
| Pricing | Inquire |
| Cas | 178925-48-9 |
| Molecular Weight | 856.69 |
| Molecular Formula | C39H46IN4O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)I |