5'-Azido-N6-Boc-5'-deoxy-2',3'-O-isopropylideneadenosine
5'-Azido-N6-Boc-5'-deoxy-2',3'-O-isopropylideneadenosine is a vital compound in the biomedical industry. It is commonly used in drug discovery and development processes. This product plays a crucial role in the synthesis of nucleoside analogues. Its unique chemical composition enables researchers to modify and optimize nucleoside structures for enhanced therapeutic efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 873556-44-6 |
| Pricing | Inquire |
| Cas | 873556-44-6 |
| Molecular Weight | 432.43 |
| Molecular Formula | C18H24N8O5 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC4=C(N=CN=C43)NC(=O)OC(C)(C)C)CN=[N+]=[N-])C |