Dexrazoxane ((S)-Razoxane)
Dexrazoxane is a cardioprotective compound against anthracyclines. It is highly protective in reducing anthracycline-induced cardiotoxicity and extravasation injury. It functions by inhibiting topoisomerase II without inducing DNA strand breaks. Dexrazoxane is a + enantiomer of razoxane.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24584-09-6 |
| Pricing | Inquire |
| Cas | 24584-09-6 |
| Molecular Weight | 268.27 |
| Molecular Formula | C11H16N4O4 |
| Canonical SMILES | CC(CN1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |