F-1
F-1 is a potent ALK and ROS1 dual inhibitor. It suppresses phospho-ALK and its relative downstream signaling pathways, with IC50s of 2.1 nM, 2.3 nM, 1.3 nM and 3.9 nM for ALKWT, ROS1WT, ALKL1196M and ALKG1202R, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2244775-31-1 |
| Pricing | Inquire |
| Cas | 2244775-31-1 |
| Molecular Weight | 519.02 |
| Molecular Formula | C22H27ClN8O3S |
| Canonical SMILES | CN1CCN(CC1)C2=NC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NS(=O)(=O)C)Cl)OC |