5-Bromo-3-indolyl b-D-glucuronide cyclohexylammonium salt
5-Bromo-3-indolyl β-D-glucuronide cyclohexylammonium salt is a highly significant chemical compound extensively employed in the biomedical domain, functioning as a remarkable substrate for the meticulous determination of β-glucuronidase activity.It considerably aids in the precise assessment and quantification of enzymatic levels.
| Supplier | BOC Sciences |
|---|---|
| Product # | 199326-16-4 |
| Pricing | Inquire |
| Cas | 199326-16-4 |
| Molecular Weight | 487.34 |
| Molecular Formula | C14H14BrNO7.C6H13N |
| Canonical SMILES | C1CCC(CC1)N.C1=CC2=C(C=C1Br)C(=CN2)OC3C(C(C(C(O3)C(=O)O)O)O)O |