TC-S 7009
TC-S 7009 is a high affinity and selective HIF-2α inhibitor (Kd = 81 nM) that displays >60-fold selectivity for HIF-2α over HIF-1α. TC-S 7009 binds to the HIF-2α PAS-B domain to disrupt HIF-2α-ARNT heterodimerization, decrease HIF-2α DNA-binding and suppress expression of HIF-2α target genes in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1422955-31-4 |
| Pricing | Inquire |
| Cas | 1422955-31-4 |
| Molecular Weight | 308.65 |
| Molecular Formula | C12H6ClFN4O3 |
| Canonical SMILES | C1=CC2=NON=C2C(=C1NC3=CC(=CC(=C3)Cl)F)[N+](=O)[O-] |