SMER 3
SMER 3 is a selective inhibitor of a yeast SCF family E3 ubiquitin ligase (SCFMet30), and also a small molecule enhancer of rapamycin (SMER). SMER 3 directly targets the MET30 subunit and induces the expression of MET genes. SMER 3 inhibits cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67200-34-4 |
| Pricing | Inquire |
| Cas | 67200-34-4 |
| Molecular Weight | 224.18 |
| Molecular Formula | C11H4N4O2 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=NC4=NON=C4N=C3C2=O |