Anhydrohexitol G
Anhydrohexitol G is an Intriguing biomedical compound assuming a remarkable standing in research of cancerous cells, with a keen focus on breast and prostate malignancies. Its exceptional attributes grant it the power to impede tumor proliferation while fostering apoptosis.
Supplier | BOC Sciences |
---|---|
Product # | 149312-06-1 |
Pricing | Inquire |
Cas | 149312-06-1 |
Molecular Weight | 281.27 |
Molecular Formula | C11H15N5O4 |
Canonical SMILES | C1C(COC(C1O)CO)N2C=NC3=C2N=C(NC3=O)N |