LCS-1
LCS-1 is an inhibitor superoxide dismutase 1 (SOD1) inhibitor, catalyzing the conversion of superoxide ion (O2-) into H2O2 and O2 to maintain low levels of reactive oxygen species. LCS-1 can prevent serum-induced activation of the ERK and PI 3-kinase/AKT signaling pathways and inhibit the proliferation of lung adenocarcinoma cell lines.
Supplier | BOC Sciences |
---|---|
Product # | 41931-13-9 |
Pricing | Inquire |
Cas | 41931-13-9 |
Molecular Weight | 255.1 |
Molecular Formula | C11H8Cl2N2O |
Canonical SMILES | CC1=CC(=CC=C1)N2C(=O)C(=C(C=N2)Cl)Cl |