Daunorubicin EP Impurity D (Doxorubicin)
Doxorubicin is an anthracycline antibiotic produced in Str. peucetius var. caesinus. Doxorubicin has anti-Gram-positive bacteria activity and has a broad anti-tumor spectrum. Doxorubicin is an antibiotic agent that inhibits DNA topoisomerase II and induces DNA damage and apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00550 |
| Pricing | Inquire |
| Cas | 23214-92-8 |
| Molecular Weight | 543.52 |
| Molecular Formula | C27H29NO11 |
| Canonical SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O |