2,6,8-Trichloro-7-Methyl Purine
A substituted purine.A purine is a heterocyclic aromatic organic compound that consists of a pyrimidine ring fused to an imidazole ring.Purines are found in high concentration in meat and meat products, especially internal organs such as liver and kidney.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16404-16-3 |
| Pricing | Inquire |
| Cas | 16404-16-3 |
| Molecular Weight | 237.48 |
| Molecular Formula | C6H3Cl3N4 |
| Canonical SMILES | CN1C2=C(N=C(N=C2Cl)Cl)N=C1Cl |