4-Methoxyphenyl b-D-glucopyranoside
4-Methoxyphenyl β-D-glucopyranoside is a naturally occurring compound that has garnered significant attention in the research community due to its potential in suppressing tumor growth and inflammation. Pertinently, animal models have consistently demonstrated its efficacy in inhibiting cancer cell growth and reducing inflammation. Moreover, this compound has shown hopeful prospects in the therapeutic treatment of diabetes and cardiovascular diseases. With its manifold medicinal promises, 4-Methoxyphenyl β-D-glucopyranoside remains a prime target of interest for further research and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2705-129073 |
| Pricing | Inquire |
| Cas | 6032-32-2 |
| Molecular Weight | 286.28 |
| Molecular Formula | C13H18O7 |
| Canonical SMILES | COC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |