2'-Cyano-2'-deoxy-1-(b-D-arabinofuranosyl)cytosine
2'-Cyano-2'-deoxy-1-(b-D-arabinofuranosyl)cytosine is a remarkable antiviral agent extensively employed in the management of viral infections triggered by herpes viruses, specifically herpes simplex and varicella-zoster. By functioning as a nucleoside analogue, this efficacious drug proficiently impedes viral DNA synthesis, thereby thwarting viral replication and ameliorating symptoms inherent to these infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135598-68-4 |
| Pricing | Inquire |
| Cas | 135598-68-4 |
| Molecular Weight | 252.23 |
| Molecular Formula | C10H12N4O4 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)C#N |