2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]-DIOXABOROLAN-2-YL)PYRIDINE
2,5-Dichloro-3-(4,4,5,5-tetramethyl-[1,3,2]-dioxaborolan-2-yl)pyridine is a significant biomedical intermediate in constructing pharmacological agents. Specifically used in Suzuki-Miyaura coupling reactions, it serves as a precursor in drug synthesis targeting cardiovascular diseases and certain types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1073371-98-8 |
| Pricing | Inquire |
| Cas | 1073371-98-8 |
| Molecular Weight | 273.95136 |
| Molecular Formula | C11H14BCl2NO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2Cl)Cl |