N6-Benzoyl-2'-chloro-2'-deoxyadenosine
N6-Benzoyl-2'-chloro-2'-deoxyadenosine, a potent nucleotide analog, is a remarkable anti-cancer agent. Ideal for treating solid tumors, it thwarts DNA replication while targeting key enzymes that enable synthesis and repair. Studies report exceptional efficacy against leukemias, lung and pancreatic cancers. This miracle molecule unleashes a cascade of reactions leading to cell demise and tumor shrinkage.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-58-4 |
| Pricing | Inquire |
| Cas | 2095417-58-4 |
| Molecular Weight | 389.79 |
| Molecular Formula | C17H16ClN5O4 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)O)Cl |