N4-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-3'-O-(2-methoxyethyl)-5-methylcytidine
N4-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-3'-O-(2-methoxyethyl)-5-methylcytidine, an exceptionally powerful biomedicine, arises as a formidable candidate for tackling an array of diseases. In the realm of antiviral therapeutics, it assumes a menacing stance against RNA viruses such as HIV and hepatitis C, hindering their replication via disruption of viral RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 256223-98-0 |
| Pricing | Inquire |
| Cas | 256223-98-0 |
| Molecular Weight | 721.79 |
| Molecular Formula | C41H43N3O9 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OCCOC)O |