5-Methoxycarbonylmethyl-2'-O-methyluridine
5-Methoxycarbonylmethyl-2'-O-methyluridine, an indispensable biomedical compound, is extensively employed in the realm of research and development for antiviral drugs. This multifaceted compound assumes a paramount role in tackling diverse viral infections, meticulously targeting distinctive RNA viruses. Its eminent significance stems from its peculiar chemical structure which confers it with the potential to exhibit vigorous antiviral activity, hindering viral replication.
Supplier | BOC Sciences |
---|---|
Product # | B1370-292007 |
Pricing | Inquire |
Cas | 60197-31-1 |
Molecular Weight | 330.29 |
Molecular Formula | C13H18N2O8 |
Canonical SMILES | COC1C(C(OC1N2C=C(C(=O)NC2=O)CC(=O)OC)CO)O |