2'-O-(2-methoxy-2-oxoethyl)-Guanosine
2'-O-(2-methoxy-2-oxoethyl)-Guanosine is renowned as a profoundly powerful biomedicine extensively employed in the realm of viral infections and cancer reserchs. This extraordinary compound, prevalent within the biomedical industry, displays exceptional antiviral and antitumor capabilities by effectively impeding viral replication and instigating apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 433288-72-3 |
| Pricing | Inquire |
| Cas | 433288-72-3 |
| Molecular Weight | 355.30 |
| Molecular Formula | C13H17N5O7 |
| Canonical SMILES | COC(=O)COC1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O |