5-Hydroxy-1-(4-sulfophenyl)-4-(4-sulfophenylazo)pyrazole-3-carboxylic acid aluminum salt
5-Hydroxy-1-(4-sulfophenyl)-4-(4-sulfophenylazo)pyrazole-3-carboxylic acid aluminum salt, a vital dye compound utilized in the identification of aluminum within biological specimens, serves as a valuable tool in the examination of aluminum's deleterious impact on human physiology, thereby contributing significantly to the field of toxicology and health sciences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2237234-84-1 |
| Pricing | Inquire |
| Cas | 2237234-84-1 |
| Molecular Weight | 492.37 |
| Molecular Formula | C16H9AlN4O9S2 |
| Canonical SMILES | [Al].O=C(O)C1=NN(C(=O)C1N=NC2=CC=C(C=C2)S(=O)(=O)O)C3=CC=C(C=C3)S(=O)(=O)O |