PD 130883
This active molecular is a potent lipophilic quinazoline antifolate and data show that marked PD130883 suppression of thymidylate synthase slows the rate but not the extent of tetrahydrofolate cofactor interconversion to dihydrofolate upon complete suppression of dihydrofolate reductase with trimetrexate..
| Supplier | BOC Sciences |
|---|---|
| Product # | 123685-36-9 |
| Pricing | Inquire |
| Cas | 123685-36-9 |
| Molecular Weight | 349.34 |
| Molecular Formula | C18H15N5O3 |
| Canonical SMILES | C#CCN(CC1=CC2=C(C=C1)NC(=NC2=O)N)C3=CC=C(C=C3)[N+](=O)[O-] |